
Indication | Ontology | MeSH | ICD-10 |
|---|---|---|---|
| narcolepsy | EFO_0000614 | D009290 | G47.4 |
| attention deficit disorder with hyperactivity | EFO_0003888 | D001289 | F90 |
| Drug common name | Amphetamine adipate |
| INN | _ |
| Description | (S)-amphetamine is a 1-phenylpropan-2-amine that has S configuration. It has a role as a neurotoxin, an adrenergic uptake inhibitor, a dopaminergic agent, a sympathomimetic agent, a dopamine uptake inhibitor and an adrenergic agent. It is an enantiomer of a (R)-amphetamine. |
| Classification | Small molecule |
| Drug class | Stimulant, anorectic |
| Image (chem structure or protein) | ![]() |
| Structure (InChI/SMILES or Protein Sequence) | C[C@H](N)Cc1ccccc1.O=C(O)CCCCC(=O)O |
| PDB | — |
| CAS-ID | 51-64-9 |
| RxCUI | — |
| ChEMBL ID | CHEMBL1200782 |
| ChEBI ID | — |
| PubChem CID | 5826 |
| DrugBank | DB01576 |
| UNII ID | Z58RH02W4M (ChemIDplus, GSRS) |
